CAS 55338-30-2

7-hydroxy-5-methyl-3-phenyl-4H-chromen-4-one

Description:

7-Hydroxy-5-methyl-3-phenyl-4H-chromen-4-one, also known as a flavonoid compound, is characterized by its chromone backbone, which consists of a benzopyran structure. This compound features a hydroxyl group at the 7-position and a methyl group at the 5-position, contributing to its unique chemical properties and potential biological activities. The presence of a phenyl group at the 3-position enhances its aromatic character and may influence its interactions with biological targets. This compound is typically soluble in organic solvents and exhibits moderate solubility in water, depending on the pH. It is known for its antioxidant properties and potential applications in pharmaceuticals and nutraceuticals. Additionally, its structural features may allow it to participate in various chemical reactions, including those involving electrophilic substitution or complexation with metal ions. Overall, 7-hydroxy-5-methyl-3-phenyl-4H-chromen-4-one is of interest in both synthetic chemistry and medicinal research due to its diverse functional properties.

Formula: C₁₆H₁₂O₃

InChI: InChI=1/C16H12O3/c1-10-7-12(17)8-14-15(10)16(18)13(9-19-14)11-5-3-2-4-6-11/h2-9,17H,1H3

SMILES: Cc1cc(cc2c1c(=O)c(co2)c1ccccc1)O

Synonyms:

• 7-Hydroxy-5-methyl-3-phenyl-chromen-4-one
• 7-hydroxy-5-methyl-3-phenyl-4H-chromen-4-one
• 4H-1-Benzopyran-4-one, 7-hydroxy-5-methyl-3-phenyl-

5-Methyl-7-hydroxyisoflavone

CAS: 55338-30-2

5-Methyl-7-hydroxyisoflavone is a naturally occurring isoflavone metabolite, which is derived primarily from the metabolic process of certain plant-derived flavonoids. Its source includes various legumes and other plants known for their rich isoflavone profiles. The compound acts principally by modulating cellular signaling pathways, including those involved in inflammation and oxidative stress response.

Formula: C₁₆H₁₂O₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 252.26 g/mol

Ref: 3D-FM70897