CAS 5534-08-7
:1-(3,4-dihydro-1H-isochromen-1-yl)-N-(2,4,5-trimethoxybenzyl)methanamine hydrochloride
Description:
1-(3,4-dihydro-1H-isochromen-1-yl)-N-(2,4,5-trimethoxybenzyl)methanamine hydrochloride, with the CAS number 5534-08-7, is a chemical compound that belongs to the class of substituted amines. This substance features a complex molecular structure characterized by an isoquinoline-like moiety and a methanamine group, which contributes to its potential biological activity. The presence of multiple methoxy groups on the benzyl moiety enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit interesting pharmacological properties, which could include effects on neurotransmitter systems, but specific biological activities would require further investigation. Overall, its unique structural features suggest potential utility in medicinal chemistry, particularly in the development of novel therapeutic agents.
Formula:C20H26ClNO4
InChI:InChI=1/C20H25NO4.ClH/c1-22-17-11-19(24-3)18(23-2)10-15(17)12-21-13-20-16-7-5-4-6-14(16)8-9-25-20;/h4-7,10-11,20-21H,8-9,12-13H2,1-3H3;1H
SMILES:COc1cc(c(cc1CNCC1c2ccccc2CCO1)OC)OC.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Beclomethasone 21-Acetate 17-Propionate (21-(Acetyloxy)-9-chloro-11β-hydroxy-16β-methyl-3,20-dioxopregna-1,4-dien-17-yl propanoate)
CAS:Carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides etc, nesoiFormula:C27H35ClO7Color and Shape:Off-White PowderMolecular weight:506.20713Beclometasone (Beclomethasone) Dipropionate EP Impurity B
CAS:Formula:C27H35ClO7Color and Shape:White To Off-White SolidMolecular weight:507.0221-(Acetyloxy)-9-chloro-11β-hydroxy-16β-methyl-3,20-dioxopregna-1,4-dien-17-yl Propanoate (Beclometasone 21-Acetate 17-Propionate)
CAS:Controlled ProductFormula:C27H35ClO7Color and Shape:NeatMolecular weight:507.02Beclomethasone 21-Acetate 17-Propionate
CAS:Controlled ProductImpurity Beclomethasone Dipropionate EP Impurity B
Applications Beclomethasone 21-Acetate 17-Propionate (Beclomethasone Dipropionate EP Impurity B) is an impurity of Beclomethasone Dipropionate (B131030).Formula:C27H35ClO7Color and Shape:NeatMolecular weight:507.02Beclomethasone 21-acetate 17-propionate
CAS:Controlled ProductPlease enquire for more information about Beclomethasone 21-acetate 17-propionate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C27H35ClO7Purity:Min. 95%Molecular weight:507.02 g/mol






