CAS 5534-12-3
:(9xi,11beta,16beta)-9-fluoro-11,21-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-17-yl acetate
Description:
The chemical substance known as (9xi,11beta,16beta)-9-fluoro-11,21-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-17-yl acetate, with the CAS number 5534-12-3, is a synthetic corticosteroid. It is characterized by its complex steroid structure, which includes a fluorine atom and multiple hydroxyl groups that contribute to its biological activity. This compound exhibits anti-inflammatory and immunosuppressive properties, making it useful in various therapeutic applications, particularly in the treatment of conditions such as asthma, allergies, and autoimmune disorders. The presence of the acetate group enhances its lipophilicity, potentially improving its absorption and bioavailability. Additionally, the specific stereochemistry indicated by the nomenclature suggests that it may have distinct pharmacological effects compared to other corticosteroids. As with many corticosteroids, its use may be associated with side effects, and its administration should be carefully monitored. Overall, this compound represents a significant class of medications in the management of inflammatory conditions.
Formula:C24H31FO6
InChI:InChI=1/C24H31FO6/c1-13-9-18-17-6-5-15-10-16(28)7-8-21(15,3)23(17,25)19(29)11-22(18,4)24(13,20(30)12-26)31-14(2)27/h7-8,10,13,17-19,26,29H,5-6,9,11-12H2,1-4H3/t13-,17-,18-,19-,21-,22-,23?,24-/m0/s1
SMILES:C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3([C@H](C[C@]2(C)[C@]1(C(=O)CO)OC(=O)C)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Betamethasone 17-Acetate
CAS:Controlled ProductFormula:C24H31FO6Color and Shape:NeatMolecular weight:434.5
