CAS 5535-73-9

1-[(2-Chloroethyl)thio]-4-nitrobenzene

Description:

1-[(2-Chloroethyl)thio]-4-nitrobenzene, with the CAS number 5535-73-9, is an organic compound characterized by the presence of a nitro group and a chloroethylthio substituent on a benzene ring. This compound typically appears as a yellow to brown solid and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The chloroethyl group contributes to its reactivity, making it a useful building block in the synthesis of more complex molecules. The nitro group, being electron-withdrawing, can influence the compound's reactivity and stability. Additionally, the presence of sulfur in the thioether linkage can impart unique properties, such as increased nucleophilicity. Safety considerations are important when handling this compound, as it may pose health risks due to its chemical structure and potential toxicity. Proper storage and handling protocols should be followed to mitigate any hazards associated with exposure.

Formula: C₈H₈ClNO₂S

InChI: InChI=1S/C8H8ClNO2S/c9-5-6-13-8-3-1-7(2-4-8)10(11)12/h1-4H,5-6H2

InChI key: InChIKey=XSHHJXAFSBWTJU-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC=C(SCCCl)C=C1

Synonyms:

• 2-Chloroethyl p-nitrophenyl sulfide
• 1-[(2-Chloroethyl)thio]-4-nitrobenzene
• 2-Chloroethyl 4-nitrophenyl sulfide
• Benzene, 1-[(2-chloroethyl)thio]-4-nitro-
• Sulfide, 2-chloroethyl p-nitrophenyl