CAS 55353-31-6

Herbicidin A

Description:

Herbicidin A, with the CAS number 55353-31-6, is a natural product derived from certain strains of bacteria, particularly those in the genus *Streptomyces*. It is characterized by its herbicidal properties, making it effective in controlling unwanted plant growth. The compound exhibits a unique structure that contributes to its biological activity, often involving complex cyclic structures that interact with plant metabolic pathways. Herbicidin A functions by inhibiting specific enzymes or processes critical for plant growth, thereby leading to the death of targeted weeds. Its mode of action is typically selective, allowing for the potential use in agricultural settings without harming desirable crops. Additionally, as a natural herbicide, it may present a lower environmental impact compared to synthetic herbicides, aligning with sustainable agricultural practices. However, like many herbicides, its efficacy can be influenced by factors such as application rate, environmental conditions, and the specific plant species being targeted. Further research continues to explore its potential applications and mechanisms of action in both agricultural and ecological contexts.

Formula: C₂₃H₂₉N₅O₁₁

InChI: InChI=1S/C23H29N5O11/c1-4-9(6-29)21(31)38-17-13(30)15(22(32)35-3)37-11-5-10-14(39-23(11,17)33)16(34-2)20(36-10)28-8-27-12-18(24)25-7-26-19(12)28/h4,7-8,10-11,13-17,20,29-30,33H,5-6H2,1-3H3,(H2,24,25,26)/b9-4+/t10-,11-,13-,14+,15+,16-,17+,20-,23-/m1/s1

InChI key: InChIKey=LOWKANMKNQBRPJ-MRAUHCMASA-N

SMILES: O[C@]12[C@@](C[C@@]3([C@](O1)([C@@H](OC)[C@@H](O3)N4C=5C(N=C4)=C(N)N=CN5)[H])[H])(O[C@H](C(OC)=O)[C@@H](O)[C@@H]2OC(/C(=C/C)/CO)=O)[H]

Synonyms:

• D-arabino-α-L-ido-7-Undeculo-7,3-pyranose-1,4-furanuronic acid, 1-(6-amino-9H-purin-9-yl)-6,10-anhydro-1,5-dideoxy-2-O-methyl-, methyl ester, 8-[(2E)-2-(hydroxymethyl)-2-butenoate], (7R)-
• Herbicidin A

α-D-Glucose-1-phosphate sodium hydrate

CAS: 55353-31-6

α-D-Glucose-1-phosphate sodium hydrate

Purity: ≥98%

Molecular weight: 376.16g/mol

Ref: 54-BUP20337

Herbicidin A

CAS: 55353-31-6

Herbicidin A is an adenosine nucleoside antibiotic isolated from Streptomyces scopuliridis M40. Herbicidin A is also a herbicide against dicotyledonous plants.

Formula: C₂₃H₂₉N₅O₁₁

Color and Shape: Solid

Molecular weight: 551.5

Ref: TM-T36094