CAS 55353-32-7
:Herbicidin B
Description:
Herbicidin B, with the CAS number 55353-32-7, is a natural product classified as a herbicide. It is derived from certain strains of bacteria, particularly those in the genus *Streptomyces*. This compound exhibits selective herbicidal activity, primarily targeting specific plant species while minimizing harm to others, making it valuable in agricultural applications. Herbicidin B functions by disrupting essential physiological processes in plants, such as photosynthesis and growth regulation. Its mode of action involves interference with the synthesis of key biomolecules, leading to plant stress and eventual death. The compound is characterized by its complex molecular structure, which contributes to its biological activity. Additionally, Herbicidin B is of interest in research for its potential applications in integrated pest management and sustainable agriculture, as it offers an alternative to synthetic herbicides. However, like many herbicides, its environmental impact and safety profile must be carefully evaluated to ensure responsible use in agricultural practices.
Formula:C18H23N5O9
InChI:InChI=1/C18H23N5O9/c1-28-12-10-6(30-16(12)23-5-22-8-14(19)20-4-21-15(8)23)3-7-18(27,32-10)13(25)9(24)11(31-7)17(26)29-2/h4-7,9-13,16,24-25,27H,3H2,1-2H3,(H2,19,20,21)/t6-,7-,9-,10+,11+,12-,13+,16-,18-/m1/s1
InChI key:InChIKey=GZBSICLBZYSADI-DHNWSQMASA-N
SMILES:O(C)[C@@H]1[C@@]2([C@](O[C@H]1N3C=4C(N=C3)=C(N)N=CN4)(C[C@@]5([C@@](O)(O2)[C@@H](O)[C@H](O)[C@@H](C(OC)=O)O5)[H])[H])[H]
Synonyms:- Herbicidin B
- D-arabino-α-L-ido-7-Undeculo-7,3-pyranose-1,4-furanuronic acid, 1-(6-amino-9H-purin-9-yl)-6,10-anhydro-1,5-dideoxy-2-O-methyl-, methyl ester, (7S)-
- (11R)-11-C-(6-Amino-9H-purin-9-yl)-2,6:8,11-dianhydro-10-O-methyl-7-deoxy-α-L-ido-D-lyxo-5-undecoulo-5,9-pyranosonic acid methyl ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Herbicidin B
CAS:Herbicidin B exhibits herbicidal properties and activity against Gram-positive bacteria.Formula:C18H23N5O9Color and Shape:SolidMolecular weight:453.403Herbicidin B
CAS:Herbicidin B is a natural herbicidal compound, which is a secondary metabolite produced through the fermentation of certain Streptomyces species. This compound functions as a potent inhibitor of plant growth by interfering with essential physiological processes within the plant cells. The mode of action of Herbicidin B primarily involves disruption of metabolic pathways that are critical for the development and survival of plants, leading to effective control of undesired vegetation.
Formula:C18H23N5O9Purity:Min. 95%Molecular weight:453.4 g/mol

