CAS 5537-53-1

N'-[(1Z)-(4-chloro-3-nitrophenyl)methylidene]-2-[(2-methylphenyl)amino]acetohydrazide (non-preferred name)

Description:

N'-[(1Z)-(4-chloro-3-nitrophenyl)methylidene]-2-[(2-methylphenyl)amino]acetohydrazide, with the CAS number 5537-53-1, is a chemical compound characterized by its complex structure, which includes a hydrazide functional group and aromatic rings. This compound features a chloro and nitro substituent on the phenyl ring, contributing to its potential reactivity and biological activity. The presence of the methylphenylamino group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound's hydrazide moiety may also exhibit properties relevant to hydrazine derivatives, such as potential anti-inflammatory or antimicrobial activities. Its solubility and stability can vary depending on the solvent and environmental conditions, which are critical for its application in research or pharmaceutical contexts. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, this compound exemplifies the diversity of organic chemistry and the potential for novel applications in various fields.

Formula: C₁₆H₁₅ClN₄O₃

InChI: InChI=1/C16H15ClN4O3/c1-11-4-2-3-5-14(11)18-10-16(22)20-19-9-12-6-7-13(17)15(8-12)21(23)24/h2-9,18H,10H2,1H3,(H,20,22)/b19-9-

SMILES: Cc1ccccc1NCC(=N/N=C\c1ccc(c(c1)N(=O)=O)Cl)O

2-(Dimethylamino)-2-phenylacetonitrile hydrochloride

CAS: 5537-53-1

2-(Dimethylamino)-2-phenylacetonitrile hydrochloride

Purity: ≥95%

Molecular weight: 196.68g/mol

Ref: 54-OR300788