CAS 55379-71-0
:phenyl pyrrolidine-1-carboxylate
Description:
Phenyl pyrrolidine-1-carboxylate, with the CAS number 55379-71-0, is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a phenyl group attached to the nitrogen atom of the pyrrolidine ring and a carboxylate functional group, which contributes to its chemical reactivity and solubility properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of both hydrophobic (phenyl) and hydrophilic (carboxylate) components. The presence of the pyrrolidine ring may impart certain biological activities, making it of interest in medicinal chemistry and drug design. Additionally, phenyl pyrrolidine-1-carboxylate may participate in various chemical reactions, including esterification and nucleophilic substitutions, due to its functional groups. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound represents a versatile structure in organic synthesis and potential applications in pharmaceuticals.
Formula:C11H13NO2
InChI:InChI=1/C11H13NO2/c13-11(12-8-4-5-9-12)14-10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2
SMILES:c1ccc(cc1)OC(=O)N1CCCC1
Synonyms:- 1-Pyrrolidinecarboxylic Acid, Phenyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenyl pyrrolidine-1-carboxylate
CAS:<p>Phenyl pyrrolidine-1-carboxylate</p>Molecular weight:191.23g/mol
