CAS 55379-96-9

(2E)-3-(4-butoxyphenyl)prop-2-enoic acid

Description:

(2E)-3-(4-butoxyphenyl)prop-2-enoic acid, also known as a type of cinnamic acid derivative, is characterized by its unique structural features, including a prop-2-enoic acid backbone with a butoxyphenyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields such as pharmaceuticals and materials science. The presence of the butoxy group enhances its lipophilicity, which can influence its solubility and biological activity. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The geometric configuration (E) indicates the specific arrangement of substituents around the double bond, which can affect the compound's reactivity and interaction with biological targets. Overall, this compound's characteristics make it of interest for further research and potential applications in drug development and organic synthesis.

Formula: C₁₃H₁₆O₃

InChI: InChI=1/C13H16O3/c1-2-3-10-16-12-7-4-11(5-8-12)6-9-13(14)15/h4-9H,2-3,10H2,1H3,(H,14,15)/b9-6+

Synonyms:

• (2E)-3-(4-Butoxyphenyl)acrylic acid
• 2-propenoic acid, 3-(4-butoxyphenyl)-, (2E)-

3-(4-Butoxyphenyl)acrylic acid

CAS: 55379-96-9

Formula: C₁₃H₁₆O₃

Molecular weight: 220.2643

Ref: IN-DA00D8RD

(E)-3-(4-Butoxyphenyl)acrylic acid

CAS: 55379-96-9

(E)-3-(4-Butoxyphenyl)acrylic acid

Purity: 95%

Molecular weight: 220.268g/mol

Ref: 54-OR97668

4-N-Butoxycinnamic acid

CAS: 55379-96-9

4-N-Butoxycinnamic acid is a chemical compound with the molecular formula CH3(CH2)7COCH=CH(COOH). It belongs to the group of cinnamic acid derivatives, which are organic compounds that may be synthesized by condensation of malonic acid and benzene. 4-N-Butoxycinnamic acid has been shown to have anti-inflammatory properties in animal models. This compound inhibits inflammatory cytokines and their signaling pathways, thereby preventing the translocation of neutrophils into inflamed tissues.

Formula: C₁₃H₁₆O₃

Purity: Min. 95%

Molecular weight: 220.26 g/mol

Ref: 3D-FB67351