CAS 55383-37-4
:Desacetylvinblastine hydrazide
Description:
Desacetylvinblastine hydrazide is a chemical compound derived from vinblastine, a well-known alkaloid used in cancer treatment. This substance is characterized by its structural modifications, which include the removal of an acetyl group and the presence of a hydrazide functional group. It typically exhibits a complex molecular structure, contributing to its biological activity. Desacetylvinblastine hydrazide is known for its potential antitumor properties, similar to its parent compound, and is often studied for its effects on cell division and proliferation. The compound may also display varying solubility in different solvents, influencing its bioavailability and therapeutic efficacy. As with many alkaloids, it may interact with various biological targets, making it a subject of interest in medicinal chemistry and pharmacology. Safety and handling precautions are essential when working with this compound, as it may possess toxicological properties. Overall, Desacetylvinblastine hydrazide represents a significant area of research in the development of anticancer therapies.
Formula:C43H56N6O7
InChI:InChI=1S/C43H56N6O7/c1-6-39(53)21-25-22-42(38(52)56-5,33-27(13-17-48(23-25)24-39)26-11-8-9-12-30(26)45-33)29-19-28-31(20-32(29)55-4)47(3)35-41(28)15-18-49-16-10-14-40(7-2,34(41)49)36(50)43(35,54)37(51)46-44/h8-12,14,19-20,25,34-36,45,50,53-54H,6-7,13,15-18,21-24,44H2,1-5H3,(H,46,51)/t25-,34-,35+,36+,39-,40+,41+,42-,43-/m0/s1
InChI key:InChIKey=PPRGGNQLPSVURC-ZVTSDNJWSA-N
SMILES:C(C)[C@@]12[C@]3([C@]4(C=5C(N(C)[C@]4([C@](C(NN)=O)(O)[C@@H]1O)[H])=CC(OC)=C(C5)[C@]6(C(OC)=O)C7=C(C=8C(N7)=CC=CC8)CC[N@@]9C[C@](C6)(C[C@](CC)(O)C9)[H])CCN3CC=C2)[H]
Synonyms:- 2H-3,7-Methanoazacycloundecino[5,4-b]indole, vincaleukoblastin-23-oic acid deriv.
- Vincaleukoblastin-23-oic acid, O4-deacetyl-, hydrazide
- 1H-Indolizino[8,1-cd]carbazole, vincaleukoblastin-23-oic acid deriv.
- Deacetylvinblastine hydrazide
- Desacetylvinblastine hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Desacetylvinblastine hydrazide
CAS:Deacetylvinblastine hydrazide, a cytotoxic vinca alkaloid often conjugated with folic acid to produce EC145, a novel folate-receptor targeted agent.Formula:C43H56N6O7Color and Shape:SolidMolecular weight:768.94
