CAS 55385-51-8
:4-nitrophenyl 1-thio-beta-D-mannopyranoside
Description:
4-Nitrophenyl 1-thio-beta-D-mannopyranoside is a chemical compound that serves as a glycoside, specifically a thio-glycoside, which is characterized by the presence of a sulfur atom in its glycosidic bond. This compound features a 4-nitrophenyl group, which is a nitro-substituted aromatic ring, contributing to its reactivity and potential applications in biochemical assays. The beta-D-mannopyranoside moiety indicates that the sugar is in the pyranose form and has a specific stereochemistry at the anomeric carbon. This compound is often used in enzymatic studies, particularly in the context of glycosidase activity, as it can serve as a substrate for various enzymes. Its solubility in polar solvents and stability under standard laboratory conditions make it suitable for various experimental applications. Additionally, the presence of the nitrophenyl group allows for spectroscopic detection methods, enhancing its utility in research settings. Overall, 4-nitrophenyl 1-thio-beta-D-mannopyranoside is a valuable tool in carbohydrate chemistry and enzymology.
Formula:C12H15NO7S
InChI:InChI=1/C12H15NO7S/c14-5-8-9(15)10(16)11(17)12(20-8)21-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11+,12+/m1/s1
Synonyms:- beta-D-mannopyranoside, 4-nitrophenyl 1-thio-
- para-Nitrophenyl 1-thio-beta-D-mannopyranoside
- p-Nitrophenyl 1-thio-beta-D-mannopyranoside
- 4-Nitrophenyl 1-thio-beta-D-mannopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Nitrophenyl b-D-thiomannopyranoside
CAS:<p>4-Nitrophenyl b-D-thiomannopyranoside acts as a substrate for β-mannosidase and thioglycoligase. Upon enzymatic cleavage, these substrates release 4-nitrophenol, a yellow chromophore that can be detected spectrophotometrically at 405 nm, facilitating quantitative measurements of enzymatic activity. Consequently, these substrates are widely used in biochemical research, clinical diagnostics, and drug discovery for evaluating the function of specific enzymes in various biological processes.</p>Purity:Min. 95%Molecular weight:317.32 g/mol
