CymitQuimica logo

CAS 55389-75-8

:

Bis(3,4-dimethylphenyl)amine

Description:
Bis(3,4-dimethylphenyl)amine, with the CAS number 55389-75-8, is an organic compound characterized by its structure, which features two 3,4-dimethylphenyl groups attached to a central nitrogen atom. This compound is typically a solid at room temperature and is known for its role as a dye intermediate and in the synthesis of various organic materials. It exhibits good thermal stability and is soluble in organic solvents, making it useful in various chemical applications. The presence of the dimethyl groups enhances its electron-donating properties, which can influence its reactivity and interactions with other chemical species. Additionally, bis(3,4-dimethylphenyl)amine may exhibit interesting optical properties, making it relevant in the field of organic electronics and photonics. Safety data indicates that, like many amines, it should be handled with care due to potential irritant effects. Overall, this compound is significant in both industrial and research contexts, particularly in the development of advanced materials.
Formula:C16H19N
InChI:InChI=1/C16H19N/c1-11-5-7-15(9-13(11)3)17-16-8-6-12(2)14(4)10-16/h5-10,17H,1-4H3
InChI key:IMQQPEKHINRTCE-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1C)Nc1ccc(C)c(C)c1
Synonyms:
  • Aniline, N-(3,4-dimethylphenyl)-3,4-dimethyl-
  • Benzenamine, N-(3,4-dimethylphenyl)-3,4-dimethyl-
  • N-(3,4-Dimethylphenyl)-3,4-dimethylaniline
Found 5 products.