CAS 55395-07-8
:5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-3-yl 6-deoxy-alpha-L-mannopyranoside
Description:
5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-3-yl 6-deoxy-alpha-L-mannopyranoside, with the CAS number 55395-07-8, is a complex organic compound characterized by its chromone backbone, which is a fused benzopyran structure. This compound features multiple hydroxyl groups, contributing to its potential antioxidant properties. The presence of a 4-hydroxyphenyl group and a 3-methylbut-2-en-1-yl substituent suggests that it may exhibit various biological activities, including anti-inflammatory and anticancer effects. The 6-deoxy-alpha-L-mannopyranoside moiety indicates that it is a glycoside, which may influence its solubility and bioavailability. Such compounds are often studied for their pharmacological potential, particularly in the context of natural products derived from plants. The structural complexity and functional groups present in this molecule suggest that it could interact with various biological targets, making it a subject of interest in medicinal chemistry and pharmacology.
Formula:C26H28O10
InChI:InChI=1/C26H28O10/c1-11(2)4-9-15-16(28)10-17(29)18-20(31)25(36-26-22(33)21(32)19(30)12(3)34-26)23(35-24(15)18)13-5-7-14(27)8-6-13/h4-8,10,12,19,21-22,26-30,32-33H,9H2,1-3H3/t12-,19-,21+,22+,26-/m0/s1
Synonyms:- 8-((2E)-3-Methylbut-2-enyl)-3-((2S,6S,3R,4R,5R)-3,4,5-trihydroxy-6-methylperhydropyran-2-yloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
IKarisoside A
CAS:IKarisoside A(Baohuoside II) is a flavonol glycoside from the Berberidaceae plant Epimedium, with anti-inflammatory activity.Formula:C26H28O10Purity:99.83%Color and Shape:SolidMolecular weight:500.49Baohuoside II
CAS:Baohuoside II is a natural flavonoid compound, which is derived from plants, especially those belonging to the Epimedium genus. It exhibits its effects primarily through modulation of various signaling pathways, such as those involving the inhibition of specific enzymes and influencing cellular responses. This modulation can lead to the suppression of tumor growth, exhibiting potential anticancer properties. Additionally, Baohuoside II is noted for its anti-inflammatory and antioxidant activities, owing to its ability to interact with molecular targets involved in these processes.Purity:Min. 95%





