CAS 554-88-1
:Glucoiberin
Description:
Glucoiberin, with the CAS number 554-88-1, is a naturally occurring compound classified as a glucosinolate, which is primarily found in certain cruciferous vegetables, such as broccoli and Brussels sprouts. This compound is characterized by its sulfur-containing structure, which contributes to its biological activity. Glucoiberin is known for its potential health benefits, including antioxidant properties and the ability to modulate detoxification enzymes, which may play a role in cancer prevention. It is also involved in plant defense mechanisms against pests and pathogens. When hydrolyzed, glucoiberin can produce isothiocyanates, compounds that have been studied for their anticancer effects. The compound is typically stable under normal conditions but can degrade under extreme pH or temperature. Its solubility in water is moderate, and it is generally considered safe for consumption in food sources. Overall, glucoiberin represents an important area of research in both nutrition and pharmacology due to its potential health-promoting properties.
Formula:C11H21NO10S3
InChI:InChI=1S/C11H21NO10S3/c1-24(17)4-2-3-7(12-22-25(18,19)20)23-11-10(16)9(15)8(14)6(5-13)21-11/h6,8-11,13-16H,2-5H2,1H3,(H,18,19,20)/t6-,8-,9+,10-,11+,24?/m1/s1
InChI key:InChIKey=PHYYADMVYQURSX-GEINXPCQSA-N
SMILES:S(C(=NOS(=O)(=O)O)CCCS(C)=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:- 3-(Methylsulfinyl)propyl glucosinolate
- β-D-Glucopyranose, 1-thio-, 1-[4-(methylsulfinyl)-N-(sulfooxy)butanimidate]
- Glucoiberin
- Glucopyranose, 1-thio-, 1-[4-(methylsulfinyl)butyrohydroximate] NO-(hydrogen sulfate), β-D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Glucoiberin
CAS:Glucoiberin is a natural compound that has been shown to possess anticancer properties. It works by inhibiting the activity of certain proteins and enzymes that are involved in tumor growth and development. Glucoiberin has been found to be a potent inhibitor of chitinase, which is an enzyme that is often overexpressed in cancer cells. Additionally, it has been shown to induce apoptosis (programmed cell death) in human cancer cells, making it a promising candidate for cancer treatment. Glucoiberin is commonly found in Chinese medicinal herbs and can be detected in human urine after ingestion. It may also have potential as a kinase inhibitor and as an alternative to heparin therapy.
Formula:C11H21NO10S3Purity:Min. 95%Molecular weight:423.5 g/molRef: 3D-AAA55488
Discontinued product

