CAS 55400-73-2

13,13-dioxido-3,6,9,12-tetraoxa-13-thiatetradec-1-yl methanesulfonate (non-preferred name)

Description:

13,13-Dioxido-3,6,9,12-tetraoxa-13-thiatetradec-1-yl methanesulfonate, with the CAS number 55400-73-2, is a complex organic compound characterized by its unique structural features, including multiple ether and thioether linkages. This compound contains a long carbon chain, which contributes to its hydrophobic properties, while the presence of dioxido and methanesulfonate groups imparts polar characteristics, enhancing its solubility in various solvents. The tetraoxa structure indicates the presence of four ether oxygen atoms, which can influence its reactivity and interactions with other chemical species. Additionally, the thioether component may provide specific chemical reactivity, such as nucleophilicity. This compound is likely to exhibit interesting properties in terms of surfactancy, solubility, and potential applications in fields such as materials science or pharmaceuticals. However, detailed studies on its biological activity, stability, and environmental impact would be necessary to fully understand its practical applications and safety profile.

Formula: C₁₀H₂₂O₉S₂

InChI: InChI=1/C10H22O9S2/c1-20(11,12)18-9-7-16-5-3-15-4-6-17-8-10-19-21(2,13)14/h3-10H2,1-2H3

SMILES: CS(=O)(=O)OCCOCCOCCOCCOS(=O)(=O)C

1,11-Bis(methanesulfonyloxy)-3,6,9-trioxandecane

CAS: 55400-73-2

Formula: C₁₀H₂₂O₉S₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 350.4063

Ref: IN-DA00DF6V

Ms-PEG4-MS

CAS: 55400-73-2

Ms-PEG4-MS

Purity: 95%

Molecular weight: 350.41g/mol

Ref: 54-OR1006258

Ms-PEG4-Ms

CAS: 55400-73-2

Ms-PEG4-Ms is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₀H₂₂O₉S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 350.41

Ref: TM-T16149

Ms-PEG4-MS

CAS: 55400-73-2

Purity: 95%

Molecular weight: 350.07

Ref: 10-F554526

1,11-Bis(methanesulfonyloxy)-3,6,9-trioxandecane

Controlled Product

CAS: 55400-73-2

Applications 1,11-Bis(methanesulfonyloxy)-3,6,9-trioxandecane (cas# 55400-73-2) is a compound useful in organic synthesis.
References Chan, K., et al.: J. Med. Chem., 49, 6742 (2006),

Formula: C₁₀H₂₂O₉S₂

Color and Shape: Neat

Molecular weight: 350.41

Ref: TR-B485600