CAS 55405-67-9

3-Bromopyrazolo[1,5-a]pyrimidine

Description:

3-Bromopyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, with a bromine substituent at the 3-position of the pyrazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals targeting various diseases. The presence of the bromine atom can enhance its reactivity and influence its interaction with biological targets. In terms of solubility, it is generally soluble in organic solvents, which is common for many heterocyclic compounds. The compound's molecular structure contributes to its unique chemical properties, making it of interest in research related to drug discovery and development. Additionally, its synthesis often involves multi-step organic reactions, highlighting its complexity and the importance of careful handling in laboratory settings.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-5-4-9-10-3-1-2-8-6(5)10/h1-4H

SMILES: c1cnc2c(cnn2c1)Br

Synonyms:

• Pyrazolo[1,5-A]Pyrimidine, 3-Bromo-

3-bromopyrazolo[1,5-a]pyrimidine

CAS: 55405-67-9

Formula: C₆H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA003J57

3-Bromopyrazolo[1,5-a]pyrimidine

CAS: 55405-67-9

3-Bromopyrazolo[1,5-a]pyrimidine

Purity: 97%

Molecular weight: 198.02g/mol

Ref: 54-OR480583

3-Bromopyrazolo[1,5-a]pyrimidine

CAS: 55405-67-9

Purity: >95%

Molecular weight: 198.02

Ref: FT-B13933

3-Bromopyrazolo[1,5-a]pyrimidine

CAS: 55405-67-9

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F076989

3-Bromopyrazolo[1,5-a]pyrimidine

CAS: 55405-67-9

Please enquire for more information about 3-Bromopyrazolo[1,5-a]pyrimidine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₆H₄BrN₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 198.02 g/mol

Ref: 3D-FB179030