CAS 55410-21-4

ethyl 2-aminobutanoate hydrochloride

Description:

Ethyl 2-aminobutanoate hydrochloride, with the CAS number 55410-21-4, is a chemical compound that belongs to the class of amino acid derivatives. It is characterized by the presence of an ethyl ester group and an amino group attached to a butanoic acid backbone. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt, which enhances its solubility compared to its free base form. Ethyl 2-aminobutanoate hydrochloride is often used in organic synthesis and pharmaceutical applications, particularly in the development of various bioactive compounds. Its structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, it may exhibit properties such as being hygroscopic and having a specific melting point range, which are important for handling and storage. As with many chemical substances, safety data sheets should be consulted for information regarding toxicity and handling precautions.

Formula: C₆H₁₄ClNO₂

InChI: InChI=1/C6H13NO2.ClH/c1-3-5(7)6(8)9-4-2;/h5H,3-4,7H2,1-2H3;1H

SMILES: CCC(C(=O)OCC)N.Cl

Synonyms:

• Butanoic Acid, 2-Amino-, Ethyl Ester, Hydrochloride (1:1)
• Ethyl 2-aminobutanoate hydrochloride (1:1)
• Ethyl α-amino butyrate

ethyl 2-aminobutanoate hydrochloride

CAS: 55410-21-4

Formula: C₆H₁₄ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 167.6339

Ref: IN-DA003Q3E

Levetiracetam Impurity 33 HCl

CAS: 55410-21-4

Formula: C₆H₁₃NO₂·HCl

Molecular weight: 131.18 36.46

Ref: 4Z-L-0538

Ethyl alfa-amino butyrate hydrochloride

CAS: 55410-21-4

Ethyl alfa-amino butyrate hydrochloride

Purity: 98%

Molecular weight: 167.63g/mol

Ref: 54-OR951485

Ethyl 2-aminobutanoate hydrochloride

CAS: 55410-21-4

Formula: C₆H₁₄ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 167.63

Ref: 10-F446685