CAS 5543-27-1

(4-bromophenyl)(pyrrolidin-1-yl)methanone

Description:

(4-bromophenyl)(pyrrolidin-1-yl)methanone, with the CAS number 5543-27-1, is an organic compound characterized by its structural components, which include a brominated phenyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical syntheses. The pyrrolidine ring, a five-membered nitrogen-containing heterocycle, imparts basicity and can participate in nucleophilic reactions. This compound may be utilized in medicinal chemistry for the development of pharmaceuticals, particularly due to its ability to interact with biological targets. Its solubility characteristics can vary based on the solvent used, and it may exhibit moderate to high stability under standard conditions. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₁H₁₂BrNO

InChI: InChI=1/C11H12BrNO/c12-10-5-3-9(4-6-10)11(14)13-7-1-2-8-13/h3-6H,1-2,7-8H2

SMILES: C1CCN(C1)C(=O)c1ccc(cc1)Br

Synonyms:

• (4-Bromo-phenyl)-pyrrolidin-1-yl-methanone
• Methanone, (4-Bromophenyl)-1-Pyrrolidinyl-

4-(Pyrrolidinylcarbonyl)bromobenzene

CAS: 5543-27-1

Formula: C₁₁H₁₂BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.1231

Ref: IN-DA00DACE

1-(4-Bromobenzoyl)pyrrolidine

CAS: 5543-27-1

1-(4-Bromobenzoyl)pyrrolidine

Purity: 98%

Molecular weight: 254.12308g/mol

Ref: 54-OR11626

1-(4-Bromobenzoyl)pyrrolidine

CAS: 5543-27-1

Formula: C₁₁H₁₂BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.127

Ref: 10-F091219