CAS 5543-33-9

(3-phenyl-1,2,4-oxadiazol-5-yl)methanol

Description:

(3-phenyl-1,2,4-oxadiazol-5-yl)methanol is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a phenyl group attached to the oxadiazole enhances its aromatic properties, contributing to its stability and potential reactivity. The hydroxymethyl group (-CH2OH) at the 5-position of the oxadiazole ring introduces polar characteristics, making the compound soluble in polar solvents. This compound may exhibit interesting biological activities due to the oxadiazole moiety, which is often associated with various pharmacological properties. Additionally, its structure suggests potential applications in materials science, particularly in the development of organic semiconductors or fluorescent materials. The compound's CAS number, 5543-33-9, allows for easy identification and retrieval of information in chemical databases. Overall, (3-phenyl-1,2,4-oxadiazol-5-yl)methanol is a versatile compound with potential applications in both medicinal chemistry and materials science.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c12-6-8-10-9(11-13-8)7-4-2-1-3-5-7/h1-5,12H,6H2

SMILES: c1ccc(cc1)c1nc(CO)on1

Synonyms:

• 1,2,4-Oxadiazole-5-Methanol, 3-Phenyl-

(3-Phenyl-1,2,4-Oxadiazol-5-Yl)Methanol

CAS: 5543-33-9

Formula: C₉H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 176.1720

Ref: IN-DA00DCVQ

(3-Phenyl-1,2,4-oxadiazol-5-yl)methanol

CAS: 5543-33-9

3-Phenyl-1,2,4-oxadiazol-5-yl)methanol is a versatile building block that has been used in the synthesis of complex compounds and research chemicals. It is also a reagent that can be used in the laboratory to synthesize other fine chemicals. 3-Phenyl-1,2,4-oxadiazol-5-yl)methanol is an intermediate that can be used to create high quality and useful building blocks for chemical reactions. This compound has many uses as a scaffold in organic synthesis and it can be used to make valuable products such as pharmaceuticals and pesticides. 3-(3'-phenyl)-1,2,4-oxadiazole 5'-amine is listed on the Chemical Abstracts Service (CAS) database with number 5543-33-9.

Formula: C₉H₈N₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 176.17 g/mol

Ref: 3D-FP116906

(3-phenyl-1,2,4-oxadiazol-5-yl)methanol

CAS: 5543-33-9

Formula: C₉H₈N₂O₂

Purity: 95.0%

Color and Shape: Solid, Amorphous

Molecular weight: 176.175

Ref: 10-F311596