CAS 5543-97-5
:2-(4-methoxyphenyl)-1,2-diphenylethanone
Description:
2-(4-Methoxyphenyl)-1,2-diphenylethanone, also known by its CAS number 5543-97-5, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a central ethanone moiety substituted with two phenyl groups and a methoxy group on one of the phenyl rings, contributing to its overall stability and reactivity. It typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic nature. The presence of the methoxy group enhances its electron-donating properties, which can influence its reactivity in various chemical reactions, including electrophilic aromatic substitution. This compound is of interest in organic synthesis and materials science, particularly in the development of organic light-emitting diodes (OLEDs) and other electronic applications. Its photophysical properties, such as absorption and emission spectra, are also significant for applications in photochemistry and dye chemistry.
Formula:C21H18O2
InChI:InChI=1/C21H18O2/c1-23-19-14-12-17(13-15-19)20(16-8-4-2-5-9-16)21(22)18-10-6-3-7-11-18/h2-15,20H,1H3
SMILES:COc1ccc(cc1)C(c1ccccc1)C(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
