CAS 554403-49-5
:1-[(6-Chloroimidazo[2,1-b]thiazol-5-yl)sulfonyl]-1H-indole-3-ethanamine
Description:
1-[(6-Chloroimidazo[2,1-b]thiazol-5-yl)sulfonyl]-1H-indole-3-ethanamine is a chemical compound characterized by its complex structure, which includes an indole moiety and a sulfonyl group attached to an imidazo-thiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the chloro substituent may influence its reactivity and biological interactions. Additionally, the sulfonamide functional group can enhance its pharmacological properties, potentially affecting its binding affinity to biological targets. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations, to determine its therapeutic potential and safety profile. Overall, this compound represents a class of small molecules that may have significant implications in drug discovery and development.
Formula:C15H13ClN4O2S2
InChI:InChI=1S/C15H13ClN4O2S2/c16-13-14(19-7-8-23-15(19)18-13)24(21,22)20-9-10(5-6-17)11-3-1-2-4-12(11)20/h1-4,7-9H,5-6,17H2
InChI key:InChIKey=RYBOXBBYCVOYNO-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C(CCN)=C1)=CC=CC2)C=3N4C(=NC3Cl)SC=C4
Synonyms:- 1-[(6-Chloroimidazo[2,1-b]thiazol-5-yl)sulfonyl]-1H-indole-3-ethanamine
- 2-[1-(6-Chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylindol-3-yl]ethanamine
- 2-[1-[(6-Chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl]-1H-indol-3-yl]ethylamine
- 1H-Indole-3-ethanamine, 1-[(6-chloroimidazo[2,1-b]thiazol-5-yl)sulfonyl]-
- WAY 181187
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
SAX-187
CAS:SAX-187 (SAX-187) has high-affinity binding at the human 5-HT6 receptor.Formula:C15H13ClN4O2S2Purity:97.82% - 98%Color and Shape:SolidMolecular weight:380.87WAY 181187
CAS:WAY 181187 is a specific agonist of the 5-HT6 receptor. It has been shown to inhibit the signal pathways and locomotor activity in rats, and has cancer-inhibiting effects. WAY 181187 has also been shown to be an inhibitor of 5-HT6 receptors, which are involved in the transmission of serotonin signals. 5-HT6 receptors are located primarily on neurons in the brain that control locomotion, mood, anxiety and appetite. They have also been implicated as a potential target for treatment of depression and anxiety disorders. WAY 181187 is structurally similar to a serotonin molecule with an oxygen atom replaced by sulfur (5-ht). The tautomeric form of this molecule is a 5-ht agonist. This drug inhibits glutamate from binding to its receptors on neuronal cells and appears to have electrophysiological properties that are different from other drugs used for the treatment of Parkinson's disease.Formula:C15H13ClN4O2S2Purity:Min. 95%Molecular weight:380.87 g/mol


