CymitQuimica logo

CAS 55441-70-8

:

6-Amino-5-methylamino-1-methyluracil

Description:
6-Amino-5-methylamino-1-methyluracil, with the CAS number 55441-70-8, is a synthetic compound that belongs to the class of pyrimidine derivatives. This substance is characterized by the presence of multiple amino groups, which contribute to its potential biological activity. It features a uracil backbone, modified with methyl and amino substituents, which can influence its solubility and reactivity. The compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals that target specific biological pathways. Its structural modifications may enhance its interaction with biological molecules, making it a candidate for further research in areas such as antiviral or anticancer therapies. Additionally, the presence of amino groups may allow for hydrogen bonding interactions, which can be crucial for its biological function. Overall, 6-Amino-5-methylamino-1-methyluracil represents a unique chemical entity with potential implications in drug design and development.
Formula:C6H10N4O2
InChI:InChI=1/C6H10N4O2/c1-8-3-4(7)10(2)6(12)9-5(3)11/h8H,7H2,1-2H3,(H,9,11,12)
SMILES:CNc1c(N)n(C)c(=O)nc1O
Synonyms:
  • 6-amino-1-methyl-5-(methylamino)pyrimidine-2,4(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.