CAS 554438-63-0

2-Chloro-N-cyclohexyl-N-methylpropanamide

Description:

2-Chloro-N-cyclohexyl-N-methylpropanamide is a chemical compound characterized by its amide functional group, which features a carbonyl group (C=O) directly bonded to a nitrogen atom (N). The presence of a chlorine atom at the second carbon position and the cyclohexyl and methyl groups attached to the nitrogen contribute to its unique properties. This compound is typically a solid or liquid at room temperature, depending on its specific formulation and purity. It is likely to be soluble in organic solvents due to its hydrophobic cyclohexyl group, while the amide functionality may impart some degree of polarity. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety data sheets would indicate that it should be handled with care, as it may pose health risks if inhaled, ingested, or if it comes into contact with skin. Proper storage and disposal methods should be followed to mitigate any environmental impact.

Formula: C₁₀H₁₈ClNO

InChI: InChI=1S/C10H18ClNO/c1-8(11)10(13)12(2)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3

InChI key: InChIKey=VXOMDVJGNBUFAL-UHFFFAOYSA-N

SMILES: N(C(C(C)Cl)=O)(C)C1CCCCC1

Synonyms:

• Propanamide, 2-chloro-N-cyclohexyl-N-methyl-
• 2-Chloro-N-cyclohexyl-N-methylpropanamide

2-Chloro-N-cyclohexyl-N-methylpropanamide

CAS: 554438-63-0

Versatile small molecule scaffold

Formula: C₁₀H₁₈ClNO

Purity: Min. 95%

Molecular weight: 203.71 g/mol

Ref: 3D-EXA43863