CAS 554438-95-8

N-[(2-Fluorophenyl)sulfonyl]glycine

Description:

N-[(2-Fluorophenyl)sulfonyl]glycine is a chemical compound characterized by its sulfonamide functional group, which is linked to a glycine moiety. This compound features a 2-fluorophenyl group, indicating the presence of a fluorine atom on the aromatic ring, which can influence its biological activity and solubility. The sulfonyl group contributes to the compound's potential as a pharmacological agent, as sulfonamides are known for their antibacterial properties. The presence of the glycine structure suggests that it may interact with biological systems, potentially serving as an amino acid derivative. In terms of physical properties, compounds of this nature typically exhibit moderate solubility in polar solvents, and their stability can be influenced by pH and temperature. The compound's molecular interactions, including hydrogen bonding and dipole-dipole interactions, may play a significant role in its reactivity and biological efficacy. Overall, N-[(2-Fluorophenyl)sulfonyl]glycine represents a class of compounds with potential applications in medicinal chemistry and drug development.

Formula: C₈H₈FNO₄S

InChI: InChI=1S/C8H8FNO4S/c9-6-3-1-2-4-7(6)15(13,14)10-5-8(11)12/h1-4,10H,5H2,(H,11,12)

InChI key: InChIKey=VCVJBFXDPYNOJC-UHFFFAOYSA-N

SMILES: S(NCC(O)=O)(=O)(=O)C1=C(F)C=CC=C1

Synonyms:

• Glycine, N-[(2-fluorophenyl)sulfonyl]-
• N-[(2-Fluorophenyl)sulfonyl]glycine

{[(2-fluorophenyl)sulfonyl]amino}acetic acid

CAS: 554438-95-8

Formula: C₈H₈FNO₄S

Purity: 95.0%

Molecular weight: 233.21

Ref: 10-F346280