CymitQuimica logo

CAS 55453-00-4

:

P-amidinophenyl P-(6-amidino-2-*indolyl)phenyl et

Description:
P-amidinophenyl P-(6-amidino-2-indolyl)phenyl et, with the CAS number 55453-00-4, is a chemical compound that exhibits characteristics typical of amidine derivatives. These compounds often possess strong basicity due to the presence of amidine functional groups, which can engage in hydrogen bonding and interact with biological targets. The structure suggests it may have significant biological activity, potentially acting as an inhibitor or modulator in various biochemical pathways. The indole moiety is known for its role in pharmacology, often contributing to the compound's ability to interact with receptors or enzymes. Additionally, the presence of multiple aromatic rings may enhance lipophilicity, influencing the compound's solubility and permeability in biological systems. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific diseases or conditions. However, detailed studies would be necessary to fully elucidate its properties and biological effects.
Formula:C22H20ClN5O
InChI:InChI=1/C22H19N5O.ClH/c23-21(24)14-5-9-18(10-6-14)28-17-7-3-13(4-8-17)19-11-15-1-2-16(22(25)26)12-20(15)27-19;/h1-12,27H,(H3,23,24)(H3,25,26);1H
SMILES:c1cc(cc2c1cc(c1ccc(cc1)Oc1ccc(cc1)C(=N)N)[nH]2)C(=N)N.Cl
Synonyms:
  • 2-[4-(4-carbamimidoylphenoxy)phenyl]-1H-indole-6-carboximidamide hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.