CAS 55455-92-0
:Phenylpropylpiperazine; 98%
Description:
Phenylpropylpiperazine (PPP) is a chemical compound characterized by its piperazine core, which is substituted with a phenyl and a propyl group. It is often studied for its potential pharmacological effects, particularly in relation to its activity as a serotonin receptor modulator. The compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents. Its molecular structure allows for interactions with various neurotransmitter systems, making it of interest in neuropharmacology. The purity of 98% indicates a high level of refinement, which is crucial for research and potential therapeutic applications. Safety data sheets for PPP would highlight its handling precautions, as it may pose risks if ingested or inhaled. As with many piperazine derivatives, it is essential to consider its effects on the central nervous system and its potential for side effects. Overall, Phenylpropylpiperazine serves as a valuable compound in both academic research and potential medicinal applications, warranting careful study and handling.
Formula:C13H20N2
InChI:InChI=1/C13H20N2/c1-2-5-13(6-3-1)7-4-10-15-11-8-14-9-12-15/h1-3,5-6,14H,4,7-12H2
SMILES:c1ccc(cc1)CCCN1CCNCC1
Synonyms:- 1-(3-Phenylpropyl)-piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(3-Phenylpropyl)piperazine
CAS:Controlled Product<p>1-(3-Phenylpropyl)piperazine (1PP) is a piperazine derivative that can be synthesized by the condensation of 3-phenylpropylamine and formaldehyde. 1PP has been shown to have neuroprotective effects in animal models of amyotrophic lateral sclerosis (ALS), brain injury, spinal cord injury, and traumatic brain injury. It has also been shown to act as a ligand for various receptors with therapeutic potential for cancer therapy. 1PP may be able to protect neurons from oxidative damage by scavenging reactive oxygen species. This drug has also been observed to inhibit the growth of cancer cells in vitro and in vivo.</p>Formula:C13H20N2Purity:Min. 95%Molecular weight:204.31 g/mol



