CymitQuimica logo

CAS 55457-11-9

:

7-methylpyrazolo[1,5-a][1,3,5]triazin-4(6H)-one

Description:
7-Methylpyrazolo[1,5-a][1,3,5]triazin-4(6H)-one is a heterocyclic compound characterized by its unique triazine and pyrazole ring structure. This compound features a methyl group at the 7-position of the pyrazolo ring, contributing to its chemical properties and reactivity. It is known for its potential biological activity, which may include roles in medicinal chemistry and as a building block in the synthesis of more complex molecules. The presence of nitrogen atoms in its structure enhances its ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the compound may exhibit solubility in polar solvents, which is typical for many nitrogen-containing heterocycles. Its CAS number, 55457-11-9, allows for easy identification and retrieval of information regarding its properties, safety data, and applications in scientific literature. Overall, 7-methylpyrazolo[1,5-a][1,3,5]triazin-4(6H)-one is of interest in both academic and industrial research contexts due to its structural features and potential utility.
Formula:C6H6N4O
InChI:InChI=1/C6H6N4O/c1-4-2-5-7-3-8-6(11)10(5)9-4/h2-3,9H,1H3
InChI key:LZFISJZIDHEYBQ-UHFFFAOYSA-N
SMILES:Cc1cc2ncnc(=O)n2[nH]1
Found 4 products.