CAS 55470-42-3
:5-(aminomethyl)-7-pentofuranosyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Description:
5-(Aminomethyl)-7-pentofuranosyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine, with the CAS number 55470-42-3, is a chemical compound that belongs to the class of pyrrolopyrimidines. This substance features a complex structure that includes a pyrrolopyrimidine core, which is characterized by a fused pyrrole and pyrimidine ring system. The presence of the aminomethyl group suggests that it may exhibit basic properties, potentially allowing it to form hydrogen bonds and participate in various chemical reactions. The pentofuranosyl moiety indicates that it is likely involved in biological processes, possibly as a nucleoside analog, which could influence its interaction with nucleic acids or enzymes. This compound may have implications in medicinal chemistry, particularly in the development of antiviral or anticancer agents, due to its structural similarities to biologically active molecules. However, specific biological activities, solubility, stability, and other physicochemical properties would require further investigation to fully understand its potential applications and behavior in various environments.
Formula:C12H17N5O4
InChI:InChI=1/C12H17N5O4/c13-1-5-2-17(11-7(5)10(14)15-4-16-11)12-9(20)8(19)6(3-18)21-12/h2,4,6,8-9,12,18-20H,1,3,13H2,(H2,14,15,16)
SMILES:C(c1cn(c2c1c(N)ncn2)C1C(C(C(CO)O1)O)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
7-(Aminomethyl)-7-deazaadenosine
CAS:<p>7-(Aminomethyl)-7-deazaadenosine is a nucleoside that has antiviral and anticancer properties. It is a novel compound, and its synthesis involves the use of activated 2′-deoxyribonucleosides. This compound is synthesized by reacting 7-amino-7-deazaguanine with an appropriate phosphoramidite at room temperature in the presence of an activator such as ammonium hydroxide or pyridine. The product can be purified by recrystallization from methanol, followed by chromatography on silica gel using a gradient elution system. The purity of this compound can be determined by HPLC analysis with UV detection at 254 nm.<br>br>br></p>Formula:C12H17N5O4Purity:Min. 95%Molecular weight:295.29 g/mol
