CAS 5548-10-7
:indole-3-glyoxylamide
Description:
Indole-3-glyoxylamide, with the CAS number 5548-10-7, is an organic compound that features a structure derived from indole, a bicyclic compound known for its aromatic properties. This substance is characterized by the presence of a glyoxylamide functional group, which contributes to its reactivity and potential biological activity. Indole-3-glyoxylamide is typically a white to off-white solid, and it is soluble in polar solvents, which facilitates its use in various chemical reactions and biological assays. The compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the context of targeting specific biological pathways. Its structure allows for interactions with various biological molecules, making it a candidate for further research in pharmacology and biochemistry. Additionally, the compound may exhibit properties such as fluorescence or specific reactivity patterns, which can be leveraged in synthetic and analytical chemistry. Overall, indole-3-glyoxylamide represents a versatile building block in organic synthesis and a subject of interest in the study of indole derivatives.
Formula:C10H8N2O2
InChI:InChI=1/C10H8N2O2/c11-10(14)9(13)7-5-12-8-4-2-1-3-6(7)8/h1-5,12H,(H2,11,14)
SMILES:c1ccc2c(c1)c(c[nH]2)C(=O)C(=O)N
Synonyms:- 1H-Indole-3-acetamide, alpha-oxo-
- Nsc 56129
- alpha-Oxo-1H-indole-3-acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Indole-3-glyoxylamide
CAS:<p>Indole-3-glyoxylamide (3-Indoleglyoxamide) is a marine derived natural products found in Spongosorites sp.</p>Formula:C10H8N2O2Purity:99.76%Color and Shape:SoildMolecular weight:188.18Indole-3-glyoxylamide
CAS:<p>Indole-3-glyoxylamide is a fine chemical that is a versatile building block for the synthesis of complex compounds. The compound has been used in research and as a reaction component, and can be used as a speciality chemical or reagent.</p>Formula:C10H8N2O2Molecular weight:188.19 g/molIndole-3-glyoxylamide
CAS:<p>Indole-3-glyoxylamide is a synthetic compound that was originally developed as a potential anti-cancer drug. It has been shown to inhibit glycogen synthase kinase 3 (GSK-3) and thereby reduce the production of proinflammatory cytokines in bowel disease. Indole-3-glyoxylamide also inhibits inflammatory bowel disease by inhibiting secretory phospholipase A2, which prevents the release of arachidonic acid from phospholipids. This synthesis is required for the production of prostaglandins and leukotrienes, which are involved in the inflammatory process. The compound has been shown to have immunomodulatory effects in chronic bronchitis, with an inhibitory effect on neutrophil chemotaxis, macrophage activity, and cytokine production. Indole-3-glyoxylamide has also been shown to be effective against cancer cells in vitro and in vivo animal models. It is metabolized through</p>Formula:C10H8N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:188.18 g/mol
