CymitQuimica logo

CAS 55480-45-0

:

3-(4-methylpiperazin-1-yl)propanoic acid

Description:
3-(4-Methylpiperazin-1-yl)propanoic acid is an organic compound characterized by its piperazine moiety, which contributes to its biological activity and solubility properties. This compound features a propanoic acid functional group, making it a carboxylic acid, which is typically polar and can engage in hydrogen bonding. The presence of the 4-methylpiperazine ring enhances its potential for interaction with biological targets, particularly in medicinal chemistry, where such structures are often explored for their pharmacological properties. The molecular structure allows for various functional group interactions, which can influence its reactivity and stability. Additionally, the compound is likely to be soluble in polar solvents due to the carboxylic acid group, while the piperazine ring may provide some lipophilicity. Its CAS number, 55480-45-0, is a unique identifier that facilitates the search for information regarding its synthesis, applications, and safety data. Overall, this compound's characteristics make it of interest in fields such as drug development and chemical research.
Formula:C8H16N2O2
InChI:InChI=1/C8H16N2O2/c1-9-4-6-10(7-5-9)3-2-8(11)12/h2-7H2,1H3,(H,11,12)
InChI key:JSHLMMUXJIDENZ-UHFFFAOYSA-N
SMILES:CN1CCN(CCC(=O)O)CC1
Synonyms:
  • 1-Piperazinepropanoic acid, 4-methyl-
  • 4-Methyl-1-piperazinepropanoic acid
Found 4 products.