CAS 55484-62-3
:(1R,2R,3S,4R,6S)-4,6-diamino-3-hydroxy-2-(beta-D-xylofuranosyloxy)cyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranoside
Description:
The chemical substance known as "(1R,2R,3S,4R,6S)-4,6-diamino-3-hydroxy-2-(beta-D-xylofuranosyloxy)cyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranoside," with the CAS number 55484-62-3, is a complex organic compound characterized by its multiple functional groups and stereochemistry. It features a cyclohexyl ring with hydroxyl and amino substituents, contributing to its potential biological activity. The presence of a beta-D-xylofuranosyloxy group indicates that it is a glycosylated compound, which may enhance its solubility and interaction with biological systems. The stereochemical configuration, denoted by the (1R,2R,3S,4R,6S) notation, suggests specific spatial arrangements of atoms that can influence the compound's reactivity and interaction with enzymes or receptors. Such compounds are often of interest in medicinal chemistry and biochemistry due to their potential roles as pharmaceuticals or biochemical probes. Overall, this substance's unique structure may confer specific properties that are valuable in research and therapeutic applications.
Formula:C17H33N3O11
InChI:InChI=1/C17H33N3O11/c18-4-1-5(19)14(30-16-8(20)12(26)10(24)6(2-21)28-16)15(9(4)23)31-17-13(27)11(25)7(3-22)29-17/h4-17,21-27H,1-3,18-20H2/t4-,5+,6-,7-,8-,9+,10-,11+,12-,13-,14-,15-,16-,17+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Antibiotic Z-1159-2
CAS:<p>Antibiotic Z-1159-2 is an agent of biochemical.</p>Formula:C17H33N3O11Color and Shape:SolidMolecular weight:455.461
