
CAS 55485-20-6
:N-[3-[4-(2,5-Dichlorophenyl)-1-piperazinyl]propyl]acetamide
Description:
N-[3-[4-(2,5-Dichlorophenyl)-1-piperazinyl]propyl]acetamide, with the CAS number 55485-20-6, is a chemical compound that belongs to the class of piperazine derivatives. This substance is characterized by its piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. The presence of a 2,5-dichlorophenyl group contributes to its lipophilicity and potential biological activity. The acetamide functional group indicates that it may exhibit properties typical of amides, such as hydrogen bonding capabilities. This compound is often studied for its pharmacological properties, particularly in the context of neuropharmacology, as piperazine derivatives are known to interact with various neurotransmitter systems. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting central nervous system disorders. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies.
Formula:C15H21Cl2N3O
InChI:InChI=1S/C15H21Cl2N3O/c1-12(21)18-5-2-6-19-7-9-20(10-8-19)15-11-13(16)3-4-14(15)17/h3-4,11H,2,5-10H2,1H3,(H,18,21)
InChI key:InChIKey=SGYVNBUUTWSSJC-UHFFFAOYSA-N
SMILES:ClC1=C(C=C(Cl)C=C1)N2CCN(CCCNC(C)=O)CC2
Synonyms:- Acaprazine
- N-[3-[4-(2,5-Dichlorophenyl)-1-piperazinyl]propyl]acetamide
- Acetamide, N-[3-[4-(2,5-dichlorophenyl)-1-piperazinyl]propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acaprazine
CAS:Acaprazine is an adrenolytic and anxiolytic drug in the class of phenylpiperazine.Formula:C15H21Cl2N3OColor and Shape:SolidMolecular weight:330.25
