CymitQuimica logo

CAS 55494-04-7

:

Bis(trimethylsilyl)itaconate

Description:
Bis(trimethylsilyl)itaconate is an organic compound characterized by its unique structure, which includes two trimethylsilyl groups attached to an itaconate backbone. This compound is typically used in organic synthesis and polymer chemistry due to its ability to act as a versatile building block. It features a double bond in its structure, which can participate in various chemical reactions, including polymerization and cross-linking. The presence of trimethylsilyl groups enhances its stability and solubility in organic solvents, making it suitable for various applications. Additionally, the compound exhibits properties typical of esters, such as reactivity towards nucleophiles. Its molecular structure contributes to its potential use in the development of advanced materials, including coatings and adhesives. Safety data indicates that, like many organosilicon compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, bis(trimethylsilyl)itaconate is a valuable compound in the field of synthetic chemistry and materials science.
Formula:C11H20O4Si2
InChI:InChI=1/C11H22O4Si2/c1-8(9(12)13)11(10(14)15,16(2,3)4)17(5,6)7/h1H2,2-7H3,(H,12,13)(H,14,15)/p-2
SMILES:C=C(C(=O)[O-])C(C(=O)[O-])([Si](C)(C)C)[Si](C)(C)C
Synonyms:
  • Bistrimethylsilylitaconate
  • Bis(Trimethylsilyl) 2-Methylidenebutanedioate
  • 3-Methylidene-2,2-Bis(Trimethylsilyl)Butanedioate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.