CAS 55499-43-9
:3,4-Dimethylphenylboronic acid
Description:
3,4-Dimethylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a dimethyl-substituted phenyl ring. Its molecular structure features a phenyl ring with two methyl groups located at the 3 and 4 positions, which influences its reactivity and solubility. This compound is typically a white to off-white solid and is soluble in polar organic solvents, making it useful in various chemical reactions, particularly in Suzuki coupling reactions for the formation of carbon-carbon bonds. The boronic acid group allows for the formation of reversible complexes with diols, which is significant in applications such as drug delivery and sensor development. Additionally, 3,4-Dimethylphenylboronic acid can serve as a building block in organic synthesis and materials science. Its reactivity and functional properties make it valuable in medicinal chemistry and the development of boron-containing compounds. Safety precautions should be observed when handling this substance, as with all boronic acids, due to potential irritant properties.
Formula:C8H11BO2
InChI:InChI=1S/C8H11BO2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-5,10-11H,1-2H3
InChI key:InChIKey=KDVZJKOYSOFXRV-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(C)=C(C)C=C1
Synonyms:- (3,4-Dimethylphenyl)boronic acid
- 3,4-Diemthylphenylboronic Acid
- 3,4-Dimethylbenzeneboronic acid
- B-(3,4-Dimethylphenyl)boronic acid
- Boronic acid, (3,4-dimethylphenyl)-
- Boronic acid, B-(3,4-dimethylphenyl)-
- 3,4-Dimethylphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3,4-Dimethylbenzeneboronic acid, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H11BO2Purity:98+%Color and Shape:White to pale cream, PowderMolecular weight:149.983,4-Dimethylphenylboronic acid
CAS:Formula:C8H11BO2Purity:96%Color and Shape:SolidMolecular weight:149.98273,4-Dimethylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H11BO2Color and Shape:White to Almost white powder to crystalMolecular weight:149.983,4-Dimethylbenzeneboronic acid
CAS:3,4-Dimethylbenzeneboronic acidPurity:98%Color and Shape:White PowderMolecular weight:149.98g/mol3,4-Dimethylphenylboronic acid
CAS:Formula:C8H11BO2Purity:96%Color and Shape:Solid, White to off-white powderMolecular weight:149.98






