CAS 55499-44-0
:B-(2,4-Dimethylphenyl)boronic acid
Description:
B-(2,4-Dimethylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a 2,4-dimethylphenyl moiety. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents such as methanol and ethanol, while being less soluble in non-polar solvents. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and as a reagent in Suzuki coupling reactions. The presence of the dimethylphenyl group enhances its stability and reactivity, allowing for selective functionalization in complex organic molecules. Additionally, boronic acids like this one are of interest in medicinal chemistry for their potential applications in drug development and as molecular probes. Proper handling and storage are essential due to the compound's reactivity and potential environmental impact.
Formula:C8H11BO2
InChI:InChI=1S/C8H11BO2/c1-6-3-4-8(9(10)11)7(2)5-6/h3-5,10-11H,1-2H3
InChI key:InChIKey=TYONHSPZXLFWKI-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C)C=C(C)C=C1
Synonyms:- (2,4-Dimethylphenyl)boronic acid
- 2,4-Dimethylphenylboronic Acid
- B-(2,4-Dimethylphenyl)boronic acid
- Boronic acid, (2,4-dimethylphenyl)-
- Boronic acid, B-(2,4-dimethylphenyl)-
- M-Xylene-4-Boronic Acid
- 2,4-Dimethylbenzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,4-Dimethylbenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H11BO2Purity:97%Color and Shape:White, PowderMolecular weight:149.982,4-Dimethylphenylboronic acid
CAS:Formula:C8H11BO2Purity:98%Color and Shape:SolidMolecular weight:149.98272,4-Dimethylbenzeneboronic acid
CAS:2,4-Dimethylbenzeneboronic acidFormula:C8H11BO2Purity:≥95%Color and Shape: white solidMolecular weight:149.98274g/mol2,4-Dimethylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H11BO2Color and Shape:White to Light yellow powder to crystalMolecular weight:149.982,4-Dimethylphenylboronic acid
CAS:Formula:C8H11BO2Purity:98%Color and Shape:Solid, CrystallineMolecular weight:149.98(2,4-Dimethylphenyl)boronic acid
CAS:(2,4-Dimethylphenyl)boronic acid is an arylboronic acid that is used in organic synthesis. The boron atom of the 2,4-dimethylphenyl group coordinates with the metal atom in the catalyst to form a stable complex. This allows for a multilayer reaction and fluorescence to occur. The activated fluorine atoms can be used to boost the reaction by adding them to the substrate and increasing the rate of oxidation. Astragalus membranaceus and rapeseed extracts have been shown to increase the rate of oxidation as well as inhibiting the formation of disaccharides. These extracts also have shown anti-inflammatory effects when tested on rats. (2,4-Dimethylphenyl)boronic acid has also been found to interact with dihydroisoquinolines, which are compounds that are structurally similar to morphine and codeine.Formula:C8H11BO2Purity:Min. 95%Molecular weight:149.98 g/mol






