CAS 555-55-5
:Hispidin
Description:
Hispidin, with the CAS number 555-55-5, is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities and potential health benefits. It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Hispidin is often studied for its potential therapeutic effects, including anti-inflammatory, antimicrobial, and anticancer activities. The compound is typically found in various plant sources, particularly in certain fungi and herbs, where it may play a role in plant defense mechanisms. Its solubility can vary depending on the solvent used, and it may exhibit different behaviors in various pH environments. Research into hispidin continues to explore its mechanisms of action and potential applications in pharmaceuticals and nutraceuticals. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, may vary and should be referenced from reliable chemical databases or literature for precise information.
Formula:C13H10O5
InChI:InChI=1S/C13H10O5/c14-9-6-10(18-13(17)7-9)3-1-8-2-4-11(15)12(16)5-8/h1-7,14-16H/b3-1+
InChI key:InChIKey=SGJNQVTUYXCBKH-HNQUOIGGSA-N
SMILES:C(=C/C1=CC(O)=CC(=O)O1)\C2=CC(O)=C(O)C=C2
Synonyms:- 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-6-hydroxy-4H-pyran-4-one
- 2H-Pyran-2-one, 6-(3,4-dihydroxystyryl)-4-hydroxy-
- 2H-Pyran-2-one, 6-[(1E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-
- 2H-Pyran-2-one, 6-[2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-, (E)-
- 6-(3,4-Dihydroxystyryl)-4-hydroxy-2-pyrone
- 6-[(1E)-2-(3,4-Dihydroxyphenyl)ethenyl]-4-hydroxy-2H-pyran-2-one
- Hispidin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Hispidin
CAS:Formula:C13H10O5Purity:>98.0%(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:246.22Hispidin
CAS:Hispidin is a polyphenol originally, including antioxidant, anti-inflammatory, and cytoprotective propertiesFormula:C13H10O5Purity:98.27%Color and Shape:White Crystalline PowderMolecular weight:246.22Ref: TM-T7792
1mg88.00€5mg187.00€10mg298.00€25mg533.00€50mg747.00€100mg1,017.00€1mL*10mM (DMSO)207.00€Hispidin
CAS:LactoneFormula:C13H10O5Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:246.22Hispidin
CAS:Controlled ProductApplications Hispidin is a naturally occuring precursor to fungal luciferin responsible for luminosity in mushrooms.
References Lee, Y. et al.: Biol. Pharm. Bull., 31, 10 (1968); Purtov, K. et al.: Angew. Chem. Int. Ed., 54, 8124 (2014);Formula:C13H10O5Color and Shape:NeatMolecular weight:246.215Hispidin
CAS:Hispidin is a polyphenolic compound, which is a secondary metabolite commonly found in certain fungal species such as Phellinus and Inonotus. It is characterized by its ability to act as a potent antioxidant. Hispidin is primarily sourced from fungi, where it plays a role in protecting the organism from oxidative stress. The compound exerts its mode of action by scavenging free radicals and inhibiting oxidative stress pathways, contributing to the maintenance of cellular redox balance.Formula:C13H10O5Purity:Min. 95%Molecular weight:246.22 g/mol








