CAS 555-55-5: Hispidin
Description:Hispidin, with the CAS number 555-55-5, is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities and potential health benefits. It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Hispidin is often studied for its potential therapeutic effects, including anti-inflammatory, antimicrobial, and anticancer activities. The compound is typically found in various plant sources, particularly in certain fungi and herbs, where it may play a role in plant defense mechanisms. Its solubility can vary depending on the solvent used, and it may exhibit different behaviors in various pH environments. Research into hispidin continues to explore its mechanisms of action and potential applications in pharmaceuticals and nutraceuticals. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, may vary and should be referenced from reliable chemical databases or literature for precise information.
Formula:C13H10O5
InChI:InChI=1S/C13H10O5/c14-9-6-10(18-13(17)7-9)3-1-8-2-4-11(15)12(16)5-8/h1-7,14-16H/b3-1+
InChI key:InChIKey=SGJNQVTUYXCBKH-HNQUOIGGSA-N
SMILES:O=C1OC(C=CC2=CC=C(O)C(O)=C2)=CC(O)=C1
- Synonyms:
- 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-6-hydroxy-4H-pyran-4-one
- 2H-Pyran-2-one, 6-(3,4-dihydroxystyryl)-4-hydroxy-
- 2H-Pyran-2-one, 6-[(1E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-
- 2H-Pyran-2-one, 6-[2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-, (E)-
- 6-(3,4-Dihydroxystyryl)-4-hydroxy-2-pyrone
- 6-[(1E)-2-(3,4-Dihydroxyphenyl)ethenyl]-4-hydroxy-2H-pyran-2-one
- Hispidin
