CAS 555-62-4
:3-[(1-Methylhydrazinyl)methyl]phenol
Description:
3-[(1-Methylhydrazinyl)methyl]phenol, with the CAS number 555-62-4, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of a methylhydrazine moiety indicates that it contains a hydrazine functional group, which is known for its reactivity and potential as a reducing agent. This compound typically appears as a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydrophilic nature of the hydroxyl group. Its chemical properties can be influenced by the electron-donating effects of the methylhydrazinyl group, which can enhance nucleophilicity. Additionally, 3-[(1-Methylhydrazinyl)methyl]phenol may have applications in various fields, including pharmaceuticals and agrochemicals, although its handling requires caution due to the potential toxicity associated with hydrazine derivatives. Overall, this compound exemplifies the interplay between aromatic chemistry and nitrogen-containing functional groups, leading to unique reactivity and potential applications.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-10(9)6-7-3-2-4-8(11)5-7/h2-5,11H,6,9H2,1H3
InChI key:InChIKey=BJJDPKGXTMVSKI-UHFFFAOYSA-N
SMILES:C(N(C)N)C1=CC(O)=CC=C1
Synonyms:- Phenol, 3-[(1-methylhydrazinyl)methyl]-
- NSD 1034
- 3-[(1-Methylhydrazinyl)methyl]phenol
- m-Cresol, α-(1-methylhydrazino)-
- Phenol, 3-[(1-methylhydrazino)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
