CAS 5550-75-4
:1,1'-piperazine-1,4-diylbis[3-(naphthalen-1-yloxy)propan-2-ol]
Description:
1,1'-Piperazine-1,4-diylbis[3-(naphthalen-1-yloxy)propan-2-ol], with the CAS number 5550-75-4, is a synthetic organic compound characterized by its complex structure that includes a piperazine moiety and naphthalene-derived groups. This compound typically exhibits properties associated with both piperazine and naphthalene derivatives, such as potential biological activity and solubility in organic solvents. The presence of the naphthalen-1-yloxy groups suggests that it may have aromatic characteristics, which can influence its interactions with biological systems and its stability. Additionally, the propan-2-ol component indicates the presence of hydroxyl groups, which can enhance solubility in polar solvents and may contribute to hydrogen bonding interactions. Such compounds are often investigated for their pharmacological properties, including potential use in medicinal chemistry. However, specific characteristics such as melting point, boiling point, and reactivity would require empirical data for precise determination.
Formula:C30H34N2O4
InChI:InChI=1/C30H34N2O4/c33-25(21-35-29-13-5-9-23-7-1-3-11-27(23)29)19-31-15-17-32(18-16-31)20-26(34)22-36-30-14-6-10-24-8-2-4-12-28(24)30/h1-14,25-26,33-34H,15-22H2
SMILES:c1ccc2c(c1)cccc2OCC(CN1CCN(CC1)CC(COc1cccc2ccccc12)O)O
Synonyms:- 1,1'-Piperazine-1,4-diylbis[3-(1-naphthyloxy)propan-2-ol]
- 1,4-Piperazinediethanol, alpha,alpha'-bis[(1-naphthalenyloxy)methyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2’-Epi-9,10-dihydroergotamine
CAS:Impurity Dihydro Ergotamine Mesylate EP Impurity D
Applications 2’-Epidihydroergotamine is an ergot alkaloid that exhibits potential neuroprotective properties against degenerative diseases.
References French, W.N., et al.: J. Pharma. Sci., 54, 1515 (1965);Formula:C33H37N5O5Color and Shape:NeatMolecular weight:583.682’-Epidihydroergotamine
CAS:2'-Epidihydroergotamine is a reagent that is used as an intermediate in the synthesis of ergot alkaloids. 2'-Epidihydroergotamine is a fine chemical that has been used as a building block for the synthesis of other compounds. It has also been used in the production of research chemicals and speciality chemicals such as antihistamines, anticancer agents, and vasoconstrictors. This compound can be used as a versatile building block in organic synthesis reactions.Formula:C33H37N5O5Purity:Min. 95%Color and Shape:PowderMolecular weight:583.68 g/molRef: 4Z-E-617
Discontinued product




