CAS 55505-28-7

9-Methyl-1-decanol

Description:

9-Methyl-1-decanol is a long-chain alcohol characterized by its molecular structure, which includes a straight-chain hydrocarbon backbone with a hydroxyl (-OH) functional group. This compound features a methyl group attached to the ninth carbon of a decanol chain, contributing to its unique properties. It is a colorless, viscous liquid at room temperature and is typically insoluble in water due to its hydrophobic alkyl chain, but it can dissolve in organic solvents. The presence of the hydroxyl group imparts some polar characteristics, allowing for hydrogen bonding, which can influence its boiling point and solubility in various solvents. 9-Methyl-1-decanol is often used in the synthesis of surfactants, fragrances, and as a potential intermediate in organic synthesis. Its physical and chemical properties, such as boiling point and density, are influenced by the length of the carbon chain and the position of the functional groups, making it an interesting compound for various applications in the chemical industry.

Formula: C₁₁H₂₄O

InChI: InChI=1S/C11H24O/c1-11(2)9-7-5-3-4-6-8-10-12/h11-12H,3-10H2,1-2H3

InChI key: InChIKey=JTKHUJNVHQWSAY-UHFFFAOYSA-N

SMILES: C(CCCCCO)CCC(C)C

Synonyms:

• 1-Decanol, 9-methyl-
• 9-Methyl-1-decanol

9-Methyldecan-1-ol

CAS: 55505-28-7

Purity: 95%

Molecular weight: 172.3119965

Ref: 10-F752707

9-Methyldecanol

Controlled Product

CAS: 55505-28-7

Applications 9-Methyldecanol is used in the synthesis of apolipoprotein E secretion stimulator N 4909.
References Yamada, N., et al.: J. Clin. Invest., 89, 706 (1992), Hiramoto, S., et al.: J. Antibiotics, 49, 949 (1996),

Formula: C₁₁H₂₄O

Color and Shape: Neat

Molecular weight: 172.31

Ref: TR-M295160