CAS 55512-33-9: Pyridate
Description:Pyridate, with the CAS number 55512-33-9, is a chemical compound classified as a herbicide. It belongs to the pyridine family and is primarily used in agricultural applications to control a variety of weeds. Pyridate functions by inhibiting photosynthesis in target plants, leading to their eventual death. The compound is characterized by its selective action, which allows it to effectively target specific weed species while minimizing harm to desirable crops. It is typically applied post-emergence, meaning it is used after the weeds have emerged from the soil. Pyridate is known for its relatively low toxicity to mammals and birds, making it a preferred choice in integrated pest management systems. However, like many herbicides, it requires careful handling and application to minimize environmental impact and prevent resistance development in weed populations. Its efficacy can be influenced by factors such as soil type, weather conditions, and the presence of other chemicals in the environment.
Formula:C19H23ClN2O2S
InChI:InChI=1S/C19H23ClN2O2S/c1-2-3-4-5-6-10-13-25-19(23)24-16-14-17(20)21-22-18(16)15-11-8-7-9-12-15/h7-9,11-12,14H,2-6,10,13H2,1H3
InChI key:InChIKey=JTZCTMAVMHRNTR-UHFFFAOYSA-N
SMILES:O=C(OC=1C=C(Cl)N=NC1C2=CC=CC=C2)SCCCCCCCC
- Synonyms:
- Carbonothioic acid, O-(6-chloro-3-phenyl-4-pyridazinyl) S-octyl ester
- Cl 11344
- Dacaote
- Fenpyrate
- Lentagran
- Lentagran WP
- O-(3-Phenyl-6-chloropyridazin-4-yl) octylthiocarbonate
- O-(6-Chloro-3-phenyl-4-pyridazinyl) S-octyl thiocarbonate
- O-(6-chloro-3-phenylpyridazin-4-yl) S-octyl carbonothioate
- Pl 3419
- See more synonyms
- Pyridate
- Pyridate 600EC
- Tough
