CAS 55514-11-9
:malonic-2-13C acid
Description:
Malonic-2-^13C acid, also known as 2-^13C-malonate, is a stable isotopologue of malonic acid, which is a dicarboxylic acid with the molecular formula C3H4O4. The presence of the ^13C isotope indicates that one of the carbon atoms in the molecule is a heavier isotope of carbon, which is useful in various applications, particularly in NMR spectroscopy and metabolic studies. Malonic acid itself is a colorless, crystalline solid that is soluble in water and has a slightly acidic taste. It is commonly used in organic synthesis, particularly in the preparation of various derivatives and as a building block in the synthesis of larger molecules. The introduction of the ^13C label allows researchers to trace metabolic pathways and study carbon flux in biological systems. Malonic-2-^13C acid retains the characteristic properties of malonic acid, including its reactivity and ability to participate in various chemical reactions, such as esterification and decarboxylation.
Formula:C213CH4O4
InChI:InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1+1
Synonyms:- (2-13C)propanedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Malonic Acid-2-13C
CAS:Controlled Product<p>Applications Malonic Acid-2-13C is labelled Malonic Acid (M158005) which is a small bioactive molecule, that can be used in variuos reactions. It is the classic example of a competitive inhibitor, which acts against succinate dehydrogenase (complex II) in the respiratory electron transport chain.<br>References Weiner, N., "Malonic acid", Org. Synth.; Coll. Vol. 2: 376;<br></p>Formula:C213CH4O4Color and Shape:NeatMolecular weight:105.05
