CymitQuimica logo

CAS 55514-22-2

:

3,3′-(1,4-Phenylene)bis[5,6-diphenyl-1,2,4-triazine]

Description:
3,3′-(1,4-Phenylene)bis[5,6-diphenyl-1,2,4-triazine], with the CAS number 55514-22-2, is an organic compound characterized by its complex triazine structure, which features two diphenyltriazine moieties linked by a phenylene group. This compound exhibits notable properties such as high thermal stability and potential applications in materials science, particularly in the development of organic semiconductors and photonic devices. The presence of multiple aromatic rings contributes to its strong light absorption characteristics, making it suitable for use in dye-sensitized solar cells and as a fluorescent probe. Additionally, the triazine ring system can participate in various chemical reactions, enhancing its versatility in synthetic chemistry. Its molecular structure allows for significant π-π stacking interactions, which can influence its solid-state properties. Overall, this compound is of interest in both academic research and industrial applications due to its unique electronic properties and structural features.
Formula:C36H24N6
InChI:InChI=1S/C36H24N6/c1-5-13-25(14-6-1)31-33(27-17-9-3-10-18-27)39-41-35(37-31)29-21-23-30(24-22-29)36-38-32(26-15-7-2-8-16-26)34(40-42-36)28-19-11-4-12-20-28/h1-24H
InChI key:InChIKey=NZTWOIMQWMZIRE-UHFFFAOYSA-N
SMILES:C=1(C(=NN=C(N1)C2=CC=C(C=C2)C=3N=C(C(=NN3)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7
Synonyms:
  • 1,2,4-Triazine, 3,3′-(1,4-phenylene)bis[5,6-diphenyl-
  • 5,6,5′,6′-Tetraphenyl-3,3 ′-(1,4-phenylene)-bis[1,2,4]triazine
  • 3,3′-(1,4-Phenylene)bis[5,6-diphenyl-1,2,4-triazine]
  • Phenylene Bis-Diphenyltriazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.