CymitQuimica logo

CAS 55515-98-5

:

3,3'-dimethyl-1,1'-binaphthalene-2,2'-diol

Description:
3,3'-Dimethyl-1,1'-binaphthalene-2,2'-diol, with the CAS number 55515-98-5, is an organic compound characterized by its structure, which consists of two naphthalene rings connected by a central bond, with two hydroxyl (-OH) groups and two methyl (-CH3) groups attached to the aromatic system. This compound exhibits chirality due to the presence of stereogenic centers, leading to the existence of enantiomers. It is typically a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature. The hydroxyl groups contribute to its potential as a ligand in coordination chemistry and its ability to participate in hydrogen bonding, which can influence its solubility and reactivity. Additionally, 3,3'-dimethyl-1,1'-binaphthalene-2,2'-diol is of interest in various fields, including organic synthesis and materials science, due to its unique structural properties and potential applications in asymmetric synthesis and as a chiral auxiliary. Its stability and reactivity can be influenced by the presence of substituents and the overall molecular conformation.
Formula:C22H18O2
InChI:InChI=1/C22H18O2/c1-13-11-15-7-3-5-9-17(15)19(21(13)23)20-18-10-6-4-8-16(18)12-14(2)22(20)24/h3-12,23-24H,1-2H3
InChI key:DUCXKDDVZDDQIO-UHFFFAOYSA-N
SMILES:Cc1cc2ccccc2c(c2c3ccccc3cc(C)c2O)c1O
Synonyms:
  • [1,1'-Binaphthalene]-2,2'-Diol, 3,3'-Dimethyl-
  • 3,3'-Dimethyl-1,1'-binaphthalene-2,2'-diol
Found 4 products.