CAS 55520-67-7
:5-Vinyl-2′-deoxyuridine
Description:
5-Vinyl-2′-deoxyuridine (CAS 55520-67-7) is a nucleoside analog characterized by the presence of a vinyl group at the 5-position of the uracil base. This compound is structurally similar to deoxyuridine, with the vinyl group providing unique reactivity that can be exploited in various chemical and biological applications. It is typically a white to off-white solid and is soluble in polar solvents such as water and methanol. The compound exhibits potential as an antiviral agent and is of interest in the field of molecular biology for its ability to incorporate into nucleic acids, potentially affecting DNA synthesis and function. Its reactivity allows for further chemical modifications, making it a valuable intermediate in the synthesis of more complex nucleoside derivatives. Additionally, 5-Vinyl-2′-deoxyuridine can participate in polymerization reactions, which may be useful in the development of new materials or therapeutic agents. As with many nucleoside analogs, its biological activity and safety profile are subjects of ongoing research.
Formula:C11H14N2O5
InChI:InChI=1S/C11H14N2O5/c1-2-6-4-13(11(17)12-10(6)16)9-3-7(15)8(5-14)18-9/h2,4,7-9,14-15H,1,3,5H2,(H,12,16,17)/t7-,8+,9+/m0/s1
InChI key:InChIKey=YAAQOXBNCODRSI-DJLDLDEBSA-N
SMILES:O=C1N([C@@H]2O[C@H](CO)[C@@H](O)C2)C=C(C=C)C(=O)N1
Synonyms:- 2'-Deoxy-5-vinyluridine
- 5-Vinyl-2′-deoxyuridine
- 5-Vinyldeoxyuridine
- Uridine, 2'-Deoxy-5-Ethenyl-
- 2′-Deoxy-5-ethenyluridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-((2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-vinylpyrimidine-2,4(1H,3H)-dione
CAS:1-((2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-vinylpyrimidine-2,4(1H,3H)-dionePurity:95%Molecular weight:254.24g/mol2-Deoxy-5-vinyluridine
CAS:<p>2-Deoxy-5-vinyluridine (5-VUdR) is a chemical compound that has been shown to cause a mutation in the DNA of herpes simplex virus. The compound is then incorporated into the viral DNA and replicated with each new cell division, leading to mutations in the sequence of its genome. This mutation can either be lethal or nonlethal, depending on how it affects the function of the virus. 5-VUdR has also been shown to affect cancer cells by inhibiting their growth and causing them to undergo apoptosis. This chemical compound also has an effect on animals and humans, as it alters body mass index and causes weight loss. It does this by preventing replication of DNA in cells that produce insulin, which leads to low insulin levels and decreased appetite.END></p>Formula:C11H14N2O5Purity:Min. 95%Color and Shape:PowderMolecular weight:254.24 g/mol
