CAS 55525-27-4: tetramethyl propane-1,1,2,3-tetracarboxylate

Description:Tetramethyl propane-1,1,2,3-tetracarboxylate, with the CAS number 55525-27-4, is an organic compound characterized by its structure, which includes a central tetramethyl propane backbone with four carboxylate functional groups. This compound is typically a colorless to pale yellow liquid and is known for its relatively low volatility and high stability under standard conditions. It is soluble in organic solvents, making it useful in various chemical applications, including as a reagent in organic synthesis and as a potential building block in the production of more complex molecules. The presence of multiple carboxylate groups contributes to its acidity and reactivity, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, its unique structure may impart specific properties, such as enhanced solubility in polar solvents and potential applications in materials science and pharmaceuticals. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula:C₁₁H₁₆O₈

InChI:InChI=1/C11H16O8/c1-16-7(12)5-6(9(13)17-2)8(10(14)18-3)11(15)19-4/h6,8H,5H2,1-4H3

Synonyms:
1,1,2,3-Propanetetracarboxylic Acid, Tetramethyl Ester

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Tetramethyl 1,1,2,3-Propanetetracarboxylate REF: 3B-T2594CAS: 55525-27-4	>98.0%(GC)	100.00 €	Mon 07 Apr 25
Tetramethyl 1,1,2,3-Propanetetracarboxylate REF: IN-DA003UPWCAS: 55525-27-4	98.0%	67.00 €	Mon 14 Apr 25
Tetramethyl propane-1,1,2,3-tetracarboxylate REF: 10-F729770CAS: 55525-27-4	98% GC	To inquire	Thu 24 Apr 25
Tetramethyl 1,1,2,3-Propanetetracarboxylate REF: 3D-FCA52527CAS: 55525-27-4	Min. 95%	- - -	Discontinued product