CAS 5553-26-4

N-(prop-2-en-1-yl)-N'-(pyridin-3-ylmethyl)ethanediamide

Description:

N-(prop-2-en-1-yl)-N'-(pyridin-3-ylmethyl)ethanediamide, with the CAS number 5553-26-4, is a chemical compound characterized by its amide functional groups and a pyridine ring. This compound features a prop-2-en-1-yl group, which introduces a double bond, contributing to its reactivity and potential for polymerization. The presence of the pyridin-3-ylmethyl moiety suggests that it may exhibit biological activity, as pyridine derivatives are often associated with various pharmacological properties. The ethanediamide backbone indicates that the molecule has two amine functionalities, which can participate in hydrogen bonding and influence solubility in polar solvents. Additionally, the structural features may allow for interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structure may lead to diverse applications in organic synthesis, pharmaceuticals, and materials science, although specific properties such as melting point, boiling point, and solubility would require empirical measurement for precise characterization.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1/C11H13N3O2/c1-2-5-13-10(15)11(16)14-8-9-4-3-6-12-7-9/h2-4,6-7H,1,5,8H2,(H,13,15)(H,14,16)

SMILES: C=CCNC(=O)C(=O)NCc1cccnc1

N-benzyltetrahydro-3-thiophenamine 1,1-dioxide hydrochloride

CAS: 5553-26-4

Formula: C₁₁H₁₆ClNO₂S

Purity: 95.0%

Molecular weight: 261.76

Ref: 10-F361083