CAS 55533-52-3
:(E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-1H-isobenzofuran-5-yl]-4-methyl-hex-4-enoic acid
Description:
The chemical substance with the name "(E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-1H-isobenzofuran-5-yl]-4-methyl-hex-4-enoic acid" and CAS number "55533-52-3" is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including a hexenoic acid moiety, methoxy and hydroxyl groups, and a bicyclic isobenzofuran structure. The presence of stereocenters indicates that the compound exhibits chirality, which can influence its biological activity and interactions. The compound is likely to be soluble in organic solvents due to its hydrophobic regions, while the hydroxyl groups may impart some degree of hydrophilicity. Its intricate structure suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation. Overall, this compound exemplifies the complexity often found in natural products and synthetic organic chemistry.
Formula:C23H30O11
InChI:InChI=1/C23H30O11/c1-10(5-7-15(25)26)4-6-12-20(31-3)11(2)13-9-32-22(30)16(13)21(12)34-23-19(29)18(28)17(27)14(8-24)33-23/h4,14,17-19,23-24,27-29H,5-9H2,1-3H3,(H,25,26)/b10-4+/t14?,17-,18+,19?,23+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Mycophenolic Acid Phenolic β-D-Glucoside
CAS:Formula:C23H30O11Color and Shape:Off-White SolidMolecular weight:482.49Mycophenolic acid β-D-glucopyranoside
CAS:Mycophenolic acid β-D-glucopyranosidePurity:>98%Molecular weight:482.48g/molMycophenolic Acid Phenolic β-D-Glucoside
CAS:Controlled ProductFormula:C23H30O11Color and Shape:White To Off-WhiteMolecular weight:482.48Mycophenolic acid phenolic b-D-glucoside
CAS:<p>Mycophenolic acid phenolic b-D-glucoside is a high purity custom synthesis that can be modified to suit customer requirements. It is a complex carbohydrate with a methyl group, fluorine atom, and glycosylation. The chemical name for Mycophenolic acid phenolic b-D-glucoside is CAS No. 55533-52-3. This product is also known as Glycosylation, Oligosaccharide, sugar, Synthetic, Fluorination, Custom synthesis, Methylation, Monosaccharide, Polysaccharide, saccharide. Click modification or Modification.</p>Formula:C23H30O11Purity:Min. 95%Molecular weight:482.48 g/mol




