CymitQuimica logo

CAS 55545-80-7

:

2-(dimethylamino)-6-(trifluoromethyl)pyrimidin-4(1H)-one

Description:
2-(Dimethylamino)-6-(trifluoromethyl)pyrimidin-4(1H)-one, with the CAS number 55545-80-7, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features a dimethylamino group at the 2-position and a trifluoromethyl group at the 6-position, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, while the dimethylamino group can influence its basicity and reactivity. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential applications in pharmaceuticals, particularly in the development of biologically active compounds, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound's fluorinated moiety may impart specific interactions with biological targets, making it of interest in medicinal chemistry.
Formula:C7H8F3N3O
InChI:InChI=1/C7H8F3N3O/c1-13(2)6-11-4(7(8,9)10)3-5(14)12-6/h3H,1-2H3,(H,11,12,14)
SMILES:CN(C)c1nc(cc(n1)O)C(F)(F)F
Synonyms:
  • 2-(Dimethylamino)-6-(trifluoromethyl)pyrimidin-4-ol
  • 4-Pyrimidinol, 2-(dimethylamino)-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.