CAS 55550-84-0
:1-amino-3-methylcyclohexanecarboxylic acid
Description:
1-Amino-3-methylcyclohexanecarboxylic acid, with the CAS number 55550-84-0, is an amino acid derivative characterized by its cyclohexane ring structure. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a cyclohexane ring that also has a methyl group (-CH3) at the 3-position. The presence of these functional groups imparts both acidic and basic properties to the molecule, making it a zwitterionic species in solution. It is typically a white crystalline solid at room temperature and is soluble in water due to the polar nature of the amino and carboxylic acid groups. This compound is of interest in various fields, including organic synthesis and medicinal chemistry, as it may serve as a building block for more complex molecules or as a potential pharmaceutical agent. Its stereochemistry can also lead to different isomeric forms, which may exhibit distinct biological activities.
Formula:C8H15NO2
InChI:InChI=1/C8H15NO2/c1-6-3-2-4-8(9,5-6)7(10)11/h6H,2-5,9H2,1H3,(H,10,11)
SMILES:CC1CCCC(C1)(C(=O)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Amino-3-methylcyclohexanecarboxylic acid
CAS:Formula:C8H15NO2Color and Shape:SolidMolecular weight:157.21021-Amino-3-methylcyclohexanecarboxylic acid
CAS:1-Amino-3-methylcyclohexanecarboxylic acid is an amino acid that can inhibit the growth of Ochromonas. It has been shown to reduce the number of protozoa in a mouse model, which may be due to its ability to inhibit cyclic adenosine monophosphate (cAMP) production in phagocytes. 1-Amino-3-methylcyclohexanecarboxylic acid is also known for its glycine and l-alanine content, which are both essential for all life forms. This amino acid is found in the cells of all organisms and is necessary for protein synthesis and cell growth.Formula:C8H15NO2Purity:Min. 95%Molecular weight:157.21 g/mol

