CAS 55552-70-0
:Furan-3-boronic acid
Description:
Furan-3-boronic acid is an organic compound characterized by the presence of a furan ring and a boronic acid functional group. It has a molecular formula that includes carbon, hydrogen, and boron, reflecting its structure. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, which is a characteristic feature of boronic acids due to their ability to form hydrogen bonds. Furan-3-boronic acid is notable for its reactivity, particularly in Suzuki coupling reactions, where it serves as a versatile building block in organic synthesis, especially in the preparation of biaryl compounds. Additionally, it can participate in complexation with diols, making it useful in various applications, including sensor technology and drug development. Its stability and reactivity under different conditions make it an important compound in both academic research and industrial applications. Proper handling and storage are essential due to its potential reactivity and the need for safety precautions when working with boronic acids.
Formula:C4H5BO3
InChI:InChI=1/C4H5BO3/c6-5(7)4-1-2-8-3-4/h1-3,6-7H
SMILES:c1cocc1B(O)O
Synonyms:- 3-Furanyl-Boronic acid
- 3-Furylboronic acid (contains varying amounts of anhydride)
- 3-Furylboronic acid
- 3-Furanboronic acid
- Furan-3-Ylboronic Acid
- Furan-3-Yl-Boranediol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Furylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C4H5BO3Purity:97.0 to 119.0 %Color and Shape:White to Orange to Green powder to crystalMolecular weight:111.89Furan-3-boronic acid, 97%
CAS:Furan-3-boronic acid use furan-3-boronic acid as our coupling partner in many reactions. A chitosan uricase (UOx)-poly (furan-3-boronic acid)(PFBA)-Pd nanoparticles (PdNPs)/plated Pd (Pd plate)/multiwalled carbon nanotubes (MWCNTs)/Au electrode was prepared for fabricating an amperometric biosensorFormula:C4H5BO3Purity:97%Color and Shape:White to cream or grey, Crystals or powder or crystalline powderMolecular weight:111.89Furan-3-boronic acid
CAS:Furan-3-boronic acidFormula:C4H5BO3Purity:98%Color and Shape: faint brown solidMolecular weight:111.89169g/molFuran-3-boronic acid
CAS:Formula:C4H5BO3Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:111.89Furan-3-boronic acid
CAS:Formula:C4H5BO3Purity:97%Color and Shape:Off-white to beige powderMolecular weight:111.89





